C18H17NO — CID 154269725
2-(1-methyl-3,4-dihydroquinolin-2-ylidene)-1-phenylethanone (PubChem CID 154269725) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(1-methyl-3,4-dihydroquinolin-2-ylidene)-1-phenylethanone.
| Compound Name | 2-(1-methyl-3,4-dihydroquinolin-2-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 154269725 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(1-methyl-3,4-dihydroquinolin-2-ylidene)-1-phenylethanone |
| SMILES | CN1C(=CC(=O)c2ccccc2)CCc2ccccc21 |
| InChI | InChI=1S/C18H17NO/c1-19-16(12-11-14-7-5-6-10-17(14)19)13-18(20)15-8-3-2-4-9-15/h2-10,13H,11-12H2,1H3 |
| InChIKey | KHOZECHRUWOOBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|