C17H21NO3 — CID 10565216
3-[(2E)-4,4-dimethyl-2-phenacylidenepyrrolidin-1-yl]propanoic acid (PubChem CID 10565216) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[(2E)-4,4-dimethyl-2-phenacylidenepyrrolidin-1-yl]propanoic acid.
| Compound Name | 3-[(2E)-4,4-dimethyl-2-phenacylidenepyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10565216 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[(2E)-4,4-dimethyl-2-phenacylidenepyrrolidin-1-yl]propanoic acid |
| SMILES | CC1(C)C/C(=C\C(=O)c2ccccc2)N(CCC(=O)O)C1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2)11-14(18(12-17)9-8-16(20)21)10-15(19)13-6-4-3-5-7-13/h3-7,10H,8-9,11-12H2,1-2H3,(H,20,21)/b14-10+ |
| InChIKey | QMTSRSDKQYOYAD-GXDHUFHOSA-N |
| XLogP | 2.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|