C23H25NO3 — CID 10690088
2-[(2E)-4,4-dimethyl-2-[2-oxo-2-(4-phenylphenyl)ethylidene]pyrrolidin-1-yl]propanoic acid (PubChem CID 10690088) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[(2E)-4,4-dimethyl-2-[2-oxo-2-(4-phenylphenyl)ethylidene]pyrrolidin-1-yl]propanoic acid.
| Compound Name | 2-[(2E)-4,4-dimethyl-2-[2-oxo-2-(4-phenylphenyl)ethylidene]pyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 10690088 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 2-[(2E)-4,4-dimethyl-2-[2-oxo-2-(4-phenylphenyl)ethylidene]pyrrolidin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CC(C)(C)C/C1=C\C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO3/c1-16(22(26)27)24-15-23(2,3)14-20(24)13-21(25)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-13,16H,14-15H2,1-3H3,(H,26,27)/b20-13+ |
| InChIKey | VXEOCFNCRAZRHJ-DEDYPNTBSA-N |
| XLogP | 4.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|