C14H13NO4 — CID 77054964
4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-oxobut-2-enoic acid (PubChem CID 77054964) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-oxobut-2-enoic acid.
| Compound Name | 4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77054964 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)-4-oxobut-2-enoic acid |
| SMILES | CN1C(=O)CCc2cc(C(=O)C=CC(=O)O)ccc21 |
| InChI | InChI=1S/C14H13NO4/c1-15-11-4-2-10(12(16)5-7-14(18)19)8-9(11)3-6-13(15)17/h2,4-5,7-8H,3,6H2,1H3,(H,18,19) |
| InChIKey | GZZZIVQQUXRMOK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|