C13H12BrNO3 — CID 116822726
3-bromo-1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)propane-1,2-dione (PubChem CID 116822726) has the molecular formula C13H12BrNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is 3-bromo-1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)propane-1,2-dione.
| Compound Name | 3-bromo-1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 116822726 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 3-bromo-1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)propane-1,2-dione |
| SMILES | CN1C(=O)CCc2cc(C(=O)C(=O)CBr)ccc21 |
| InChI | InChI=1S/C13H12BrNO3/c1-15-10-4-2-9(13(18)11(16)7-14)6-8(10)3-5-12(15)17/h2,4,6H,3,5,7H2,1H3 |
| InChIKey | XGQFRTPPACFLNL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|