C14H15NO3 — CID 82294637
1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)butane-1,3-dione (PubChem CID 82294637) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)butane-1,3-dione.
| Compound Name | 1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 82294637 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1ccc2c(c1)CCC(=O)N2C |
| InChI | InChI=1S/C14H15NO3/c1-9(16)7-13(17)11-3-5-12-10(8-11)4-6-14(18)15(12)2/h3,5,8H,4,6-7H2,1-2H3 |
| InChIKey | GMPHLLAVNONKQG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|