C41H54N8 — CID 176693708
(11Z)-11-[amino(ethyl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-12-amine;(11Z)-12-[amino(propan-2-yl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-11-amine (PubChem CID 176693708) has the molecular formula C41H54N8 and a molecular weight of 658.94 g/mol. Its IUPAC name is (11Z)-11-[amino(ethyl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-12-amine;(11Z)-12-[amino(propan-2-yl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-11-amine.
| Compound Name | (11Z)-11-[amino(ethyl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-12-amine;(11Z)-12-[amino(propan-2-yl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-11-amine |
|---|---|
| PubChem CID | 176693708 |
| Molecular Formula | C41H54N8 |
| Molecular Weight | 658.94 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | (11Z)-11-[amino(ethyl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-12-amine;(11Z)-12-[amino(propan-2-yl)amino]-5-propan-2-yl-6H-benzo[c][1]benzazocin-11-amine |
| SMILES | CC(C)N(N)/C1=C(\N)c2ccccc2CN(C(C)C)c2ccccc21.CCN(N)/C1=C(\N)c2ccccc2N(C(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C21H28N4.C20H26N4/c1-14(2)24-13-16-9-5-6-10-17(16)20(22)21(25(23)15(3)4)18-11-7-8-12-19(18)24;1-4-24(22)20-16-10-6-5-9-15(16)13-23(14(2)3)18-12-8-7-11-17(18)19(20)21/h5-12,14-15H,13,22-23H2,1-4H3;5-12,14H,4,13,21-22H2,1-3H3/b21-20-;20-19- |
| InChIKey | NCIWLPMCONHOOI-RZYQMCMASA-N |
| XLogP | 7.18 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.94 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|