C20H29N3 — CID 155741393
ethane;(11Z)-5-methyl-6H-benzo[c][1]benzazocine-11,12-diamine (PubChem CID 155741393) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethane;(11Z)-5-methyl-6H-benzo[c][1]benzazocine-11,12-diamine.
| Compound Name | ethane;(11Z)-5-methyl-6H-benzo[c][1]benzazocine-11,12-diamine |
|---|---|
| PubChem CID | 155741393 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | ethane;(11Z)-5-methyl-6H-benzo[c][1]benzazocine-11,12-diamine |
| SMILES | CC.CC.CN1Cc2ccccc2/C(N)=C(/N)c2ccccc21 |
| InChI | InChI=1S/C16H17N3.2C2H6/c1-19-10-11-6-2-3-7-12(11)15(17)16(18)13-8-4-5-9-14(13)19;2*1-2/h2-9H,10,17-18H2,1H3;2*1-2H3/b16-15-;; |
| InChIKey | NLDRUVVXFNCCAE-NDXGFPCWSA-N |
| XLogP | 4.43 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|