C19H22N2 — CID 142452538
3,11-dimethyl-3,11-diazatetracyclo[11.4.0.02,4.05,10]heptadeca-1(17),2(4),5,7,9,13,15-heptaene;ethane (PubChem CID 142452538) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3,11-dimethyl-3,11-diazatetracyclo[11.4.0.02,4.05,10]heptadeca-1(17),2(4),5,7,9,13,15-heptaene;ethane.
| Compound Name | 3,11-dimethyl-3,11-diazatetracyclo[11.4.0.02,4.05,10]heptadeca-1(17),2(4),5,7,9,13,15-heptaene;ethane |
|---|---|
| PubChem CID | 142452538 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3,11-dimethyl-3,11-diazatetracyclo[11.4.0.02,4.05,10]heptadeca-1(17),2(4),5,7,9,13,15-heptaene;ethane |
| SMILES | CC.CN1C2=C1c1ccccc1N(C)Cc1ccccc12 |
| InChI | InChI=1S/C17H16N2.C2H6/c1-18-11-12-7-3-4-8-13(12)16-17(19(16)2)14-9-5-6-10-15(14)18;1-2/h3-10H,11H2,1-2H3;1-2H3 |
| InChIKey | YCRADKXLNXPFNJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|