C20H26N4 — CID 176713426
(11E)-11-(aminodiazenyl)-12-ethyl-5-methyl-6H-benzo[c][1]benzazocine;ethane (PubChem CID 176713426) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is (11E)-11-(aminodiazenyl)-12-ethyl-5-methyl-6H-benzo[c][1]benzazocine;ethane.
| Compound Name | (11E)-11-(aminodiazenyl)-12-ethyl-5-methyl-6H-benzo[c][1]benzazocine;ethane |
|---|---|
| PubChem CID | 176713426 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (11E)-11-(aminodiazenyl)-12-ethyl-5-methyl-6H-benzo[c][1]benzazocine;ethane |
| SMILES | CC.CC/C1=C(\N=N\N)c2ccccc2CN(C)c2ccccc21 |
| InChI | InChI=1S/C18H20N4.C2H6/c1-3-14-16-10-6-7-11-17(16)22(2)12-13-8-4-5-9-15(13)18(14)20-21-19;1-2/h4-11H,3,12H2,1-2H3,(H2,19,20);1-2H3/b18-14+; |
| InChIKey | MYOYQAYOVPRJPN-LSJACRKWSA-N |
| XLogP | 5.27 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|