C17H24N2 — CID 164912251
(3Z,5E)-4-ethyl-N,1,3,5-tetramethyl-2H-1-benzazocin-6-amine (PubChem CID 164912251) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (3Z,5E)-4-ethyl-N,1,3,5-tetramethyl-2H-1-benzazocin-6-amine.
| Compound Name | (3Z,5E)-4-ethyl-N,1,3,5-tetramethyl-2H-1-benzazocin-6-amine |
|---|---|
| PubChem CID | 164912251 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (3Z,5E)-4-ethyl-N,1,3,5-tetramethyl-2H-1-benzazocin-6-amine |
| SMILES | CCC1=C(\C)CN(C)c2ccccc2/C(NC)=C\1C |
| InChI | InChI=1S/C17H24N2/c1-6-14-12(2)11-19(5)16-10-8-7-9-15(16)17(18-4)13(14)3/h7-10,18H,6,11H2,1-5H3/b14-12-,17-13+ |
| InChIKey | UUQUAATXNZSSAI-XSZMWJROSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|