C20H21N — CID 171814428
14-methyl-14-azatetracyclo[14.4.0.02,7.08,13]icosa-1(20),2(7),8,10,12,16,18-heptaene (PubChem CID 171814428) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 14-methyl-14-azatetracyclo[14.4.0.02,7.08,13]icosa-1(20),2(7),8,10,12,16,18-heptaene.
| Compound Name | 14-methyl-14-azatetracyclo[14.4.0.02,7.08,13]icosa-1(20),2(7),8,10,12,16,18-heptaene |
|---|---|
| PubChem CID | 171814428 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 14-methyl-14-azatetracyclo[14.4.0.02,7.08,13]icosa-1(20),2(7),8,10,12,16,18-heptaene |
| SMILES | CN1Cc2ccccc2C2=C(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H21N/c1-21-14-15-8-2-3-9-16(15)17-10-4-5-11-18(17)19-12-6-7-13-20(19)21/h2-3,6-9,12-13H,4-5,10-11,14H2,1H3 |
| InChIKey | BNXXBXSOVPMIJG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|