C20H20IN — CID 174304934
8-iodo-8-azatetracyclo[14.5.0.02,7.010,15]henicosa-1(16),2,4,6,10,12,14-heptaene (PubChem CID 174304934) has the molecular formula C20H20IN and a molecular weight of 401.29 g/mol. Its IUPAC name is 8-iodo-8-azatetracyclo[14.5.0.02,7.010,15]henicosa-1(16),2,4,6,10,12,14-heptaene.
| Compound Name | 8-iodo-8-azatetracyclo[14.5.0.02,7.010,15]henicosa-1(16),2,4,6,10,12,14-heptaene |
|---|---|
| PubChem CID | 174304934 |
| Molecular Formula | C20H20IN |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 8-iodo-8-azatetracyclo[14.5.0.02,7.010,15]henicosa-1(16),2,4,6,10,12,14-heptaene |
| SMILES | IN1Cc2ccccc2C2=C(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H20IN/c21-22-14-15-8-4-5-9-16(15)17-10-2-1-3-11-18(17)19-12-6-7-13-20(19)22/h4-9,12-13H,1-3,10-11,14H2 |
| InChIKey | CWXLTXGPIHJVIS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|