C13H18IN — CID 20517477
bicyclo[4.2.0]octa-1,3,5-triene;1-iodopiperidine (PubChem CID 20517477) has the molecular formula C13H18IN and a molecular weight of 315.20 g/mol. Its IUPAC name is bicyclo[4.2.0]octa-1,3,5-triene;1-iodopiperidine.
| Compound Name | bicyclo[4.2.0]octa-1,3,5-triene;1-iodopiperidine |
|---|---|
| PubChem CID | 20517477 |
| Molecular Formula | C13H18IN |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | bicyclo[4.2.0]octa-1,3,5-triene;1-iodopiperidine |
| SMILES | IN1CCCCC1.c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C8H8.C5H10IN/c1-2-4-8-6-5-7(8)3-1;6-7-4-2-1-3-5-7/h1-4H,5-6H2;1-5H2 |
| InChIKey | ZTKRANZUJFFABL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|