C14H18N2O — CID 19094699
1-piperidin-1-yl-3,4-dihydroquinolin-2-one (PubChem CID 19094699) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-piperidin-1-yl-3,4-dihydroquinolin-2-one.
| Compound Name | 1-piperidin-1-yl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 19094699 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-piperidin-1-yl-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1N1CCCCC1 |
| InChI | InChI=1S/C14H18N2O/c17-14-9-8-12-6-2-3-7-13(12)16(14)15-10-4-1-5-11-15/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | LEBCEODXZCAWKA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |