C11H13N3O2 — CID 141154790
N'-hydroxy-2-(2-oxo-3,4-dihydroquinolin-1-yl)ethanimidamide (PubChem CID 141154790) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is N'-hydroxy-2-(2-oxo-3,4-dihydroquinolin-1-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(2-oxo-3,4-dihydroquinolin-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 141154790 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N'-hydroxy-2-(2-oxo-3,4-dihydroquinolin-1-yl)ethanimidamide |
| SMILES | N/C(CN1C(=O)CCc2ccccc21)=N\O |
| InChI | InChI=1S/C11H13N3O2/c12-10(13-16)7-14-9-4-2-1-3-8(9)5-6-11(14)15/h1-4,16H,5-7H2,(H2,12,13) |
| InChIKey | XZPZCLYHBDZKAN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|