C11H12ClNO — CID 12992360
1-(2-chloroethyl)-3,4-dihydroquinolin-2-one (PubChem CID 12992360) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-(2-chloroethyl)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 12992360 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 1-(2-chloroethyl)-3,4-dihydroquinolin-2-one |
| SMILES | O=C1CCc2ccccc2N1CCCl |
| InChI | InChI=1S/C11H12ClNO/c12-7-8-13-10-4-2-1-3-9(10)5-6-11(13)14/h1-4H,5-8H2 |
| InChIKey | NHQHUBOLAKEMOP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|