C15H20N2OS — CID 65249399
2,2-dimethyl-4-(2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide (PubChem CID 65249399) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide |
|---|---|
| PubChem CID | 65249399 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2,2-dimethyl-4-(2-oxo-3,4-dihydroquinolin-1-yl)butanethioamide |
| SMILES | CC(C)(CCN1C(=O)CCc2ccccc21)C(N)=S |
| InChI | InChI=1S/C15H20N2OS/c1-15(2,14(16)19)9-10-17-12-6-4-3-5-11(12)7-8-13(17)18/h3-6H,7-10H2,1-2H3,(H2,16,19) |
| InChIKey | DMQGQCLYXKVKDD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|