C12H15NO2 — CID 103935304
1-[(2S)-2-hydroxypropyl]-3,4-dihydroquinolin-2-one (PubChem CID 103935304) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxypropyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-[(2S)-2-hydroxypropyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 103935304 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-[(2S)-2-hydroxypropyl]-3,4-dihydroquinolin-2-one |
| SMILES | C[C@H](O)CN1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C12H15NO2/c1-9(14)8-13-11-5-3-2-4-10(11)6-7-12(13)15/h2-5,9,14H,6-8H2,1H3/t9-/m0/s1 |
| InChIKey | RVMMFIKIXPYMPU-VIFPVBQESA-N |
| XLogP | 1.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |