C15H20ClNO — CID 43168521
1-(5-chloropentyl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 43168521) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 1-(5-chloropentyl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-(5-chloropentyl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 43168521 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(5-chloropentyl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | O=C1CCCc2ccccc2N1CCCCCCl |
| InChI | InChI=1S/C15H20ClNO/c16-11-4-1-5-12-17-14-9-3-2-7-13(14)8-6-10-15(17)18/h2-3,7,9H,1,4-6,8,10-12H2 |
| InChIKey | FKMKZJGKNIYPHC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|