C13H18ClNOS — CID 19881040
4-(4-chlorobutyl)-6,7,8,9-tetrahydrothieno[3,2-b]azocin-5-one (PubChem CID 19881040) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is 4-(4-chlorobutyl)-6,7,8,9-tetrahydrothieno[3,2-b]azocin-5-one.
| Compound Name | 4-(4-chlorobutyl)-6,7,8,9-tetrahydrothieno[3,2-b]azocin-5-one |
|---|---|
| PubChem CID | 19881040 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(4-chlorobutyl)-6,7,8,9-tetrahydrothieno[3,2-b]azocin-5-one |
| SMILES | O=C1CCCCc2sccc2N1CCCCCl |
| InChI | InChI=1S/C13H18ClNOS/c14-8-3-4-9-15-11-7-10-17-12(11)5-1-2-6-13(15)16/h7,10H,1-6,8-9H2 |
| InChIKey | VCWLOXRXNVJPSM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|