C14H21NO3S — CID 63748983
4-(2,2-diethoxyethyl)-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one (PubChem CID 63748983) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-(2,2-diethoxyethyl)-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one.
| Compound Name | 4-(2,2-diethoxyethyl)-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one |
|---|---|
| PubChem CID | 63748983 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-(2,2-diethoxyethyl)-7,8-dihydro-6H-thieno[3,2-b]azepin-5-one |
| SMILES | CCOC(CN1C(=O)CCCc2sccc21)OCC |
| InChI | InChI=1S/C14H21NO3S/c1-3-17-14(18-4-2)10-15-11-8-9-19-12(11)6-5-7-13(15)16/h8-9,14H,3-7,10H2,1-2H3 |
| InChIKey | MVXIBHWIAJDWOZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|