C10H17NO4 — CID 60976210
1-(2,2-dimethoxyethyl)azepane-2,7-dione (PubChem CID 60976210) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)azepane-2,7-dione.
| Compound Name | 1-(2,2-dimethoxyethyl)azepane-2,7-dione |
|---|---|
| PubChem CID | 60976210 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)azepane-2,7-dione |
| SMILES | COC(CN1C(=O)CCCCC1=O)OC |
| InChI | InChI=1S/C10H17NO4/c1-14-10(15-2)7-11-8(12)5-3-4-6-9(11)13/h10H,3-7H2,1-2H3 |
| InChIKey | MDEFOVTWGGSEPE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|