C7H11NO3 — CID 134892605
1-methoxyazepane-2,7-dione (PubChem CID 134892605) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-methoxyazepane-2,7-dione.
| Compound Name | 1-methoxyazepane-2,7-dione |
|---|---|
| PubChem CID | 134892605 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-methoxyazepane-2,7-dione |
| SMILES | CON1C(=O)CCCCC1=O |
| InChI | InChI=1S/C7H11NO3/c1-11-8-6(9)4-2-3-5-7(8)10/h2-5H2,1H3 |
| InChIKey | VISQMLYXHNEXCE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|