C6H9NO4 — CID 167136496
3-hydroxy-1-methoxypiperidine-2,6-dione (PubChem CID 167136496) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is 3-hydroxy-1-methoxypiperidine-2,6-dione.
| Compound Name | 3-hydroxy-1-methoxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 167136496 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | 3-hydroxy-1-methoxypiperidine-2,6-dione |
| SMILES | CON1C(=O)CCC(O)C1=O |
| InChI | InChI=1S/C6H9NO4/c1-11-7-5(9)3-2-4(8)6(7)10/h4,8H,2-3H2,1H3 |
| InChIKey | KVOHILOJYGHTMR-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|