C7H13NO6S — CID 143201106
ethane;1-methoxy-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 143201106) has the molecular formula C7H13NO6S and a molecular weight of 239.25 g/mol. Its IUPAC name is ethane;1-methoxy-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | ethane;1-methoxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 143201106 |
| Molecular Formula | C7H13NO6S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | ethane;1-methoxy-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | CC.CON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C5H7NO6S.C2H6/c1-12-6-4(7)2-3(5(6)8)13(9,10)11;1-2/h3H,2H2,1H3,(H,9,10,11);1-2H3 |
| InChIKey | VNHBAUDBVQJPNJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|