C13H21NO7S — CID 126610907
2,5-dioxo-1-(2-propylhexanoyloxy)pyrrolidine-3-sulfonic acid (PubChem CID 126610907) has the molecular formula C13H21NO7S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2,5-dioxo-1-(2-propylhexanoyloxy)pyrrolidine-3-sulfonic acid.
| Compound Name | 2,5-dioxo-1-(2-propylhexanoyloxy)pyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 126610907 |
| Molecular Formula | C13H21NO7S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2,5-dioxo-1-(2-propylhexanoyloxy)pyrrolidine-3-sulfonic acid |
| SMILES | CCCCC(CCC)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H21NO7S/c1-3-5-7-9(6-4-2)13(17)21-14-11(15)8-10(12(14)16)22(18,19)20/h9-10H,3-8H2,1-2H3,(H,18,19,20) |
| InChIKey | PBXFWHUNIGAGNO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|