C5H6NO6S- — CID 58252795
1-methoxy-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 58252795) has the molecular formula C5H6NO6S- and a molecular weight of 208.17 g/mol. Its IUPAC name is 1-methoxy-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | 1-methoxy-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 58252795 |
| Molecular Formula | C5H6NO6S- |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 1-methoxy-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | CON1C(=O)CC(S(=O)(=O)[O-])C1=O |
| InChI | InChI=1S/C5H7NO6S/c1-12-6-4(7)2-3(5(6)8)13(9,10)11/h3H,2H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | WQZPUWMOQOEQHK-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|