C22H36NNaO7S — CID 53442213
sodium 1-octadec-9-enoyloxy-2,5-dioxopyrrolidine-3-sulfonate (PubChem CID 53442213) has the molecular formula C22H36NNaO7S and a molecular weight of 481.59 g/mol. Its IUPAC name is sodium 1-octadec-9-enoyloxy-2,5-dioxopyrrolidine-3-sulfonate.
| Compound Name | sodium 1-octadec-9-enoyloxy-2,5-dioxopyrrolidine-3-sulfonate |
|---|---|
| PubChem CID | 53442213 |
| Molecular Formula | C22H36NNaO7S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | sodium 1-octadec-9-enoyloxy-2,5-dioxopyrrolidine-3-sulfonate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C22H37NO7S.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)30-23-20(24)18-19(22(23)26)31(27,28)29;/h9-10,19H,2-8,11-18H2,1H3,(H,27,28,29);/q;+1/p-1 |
| InChIKey | FZVVLJSNKVOPRF-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|