About disodium;propyl octadec-9-enoate;sulfate
disodium;propyl octadec-9-enoate;sulfate (PubChem CID 173063888) has the molecular formula C21H40Na2O6S
and a molecular weight of 466.59 g/mol. Its IUPAC name is disodium;propyl octadec-9-enoate;sulfate.
Molecular Properties
| Compound Name | disodium;propyl octadec-9-enoate;sulfate |
| PubChem CID | 173063888 |
| Molecular Formula | C21H40Na2O6S |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | disodium;propyl octadec-9-enoate;sulfate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCC.O=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H40O2.2Na.H2O4S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20-4-2;;;1-5(2,3)4/h11-12H,3-10,13-20H2,1-2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | QNTATQBFRWBHMN-UHFFFAOYSA-L |
| XLogP | -0.35 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze disodium;propyl octadec-9-enoate;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;propyl octadec-9-enoate;sulfate?
The IUPAC name of disodium;propyl octadec-9-enoate;sulfate (CID 173063888) is disodium;propyl octadec-9-enoate;sulfate.
What is the SMILES notation for disodium;propyl octadec-9-enoate;sulfate?
The canonical SMILES for disodium;propyl octadec-9-enoate;sulfate is CCCCCCCCC=CCCCCCCCC(=O)OCCC.O=S(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;propyl octadec-9-enoate;sulfate?
The InChIKey is QNTATQBFRWBHMN-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H40O2.2Na.H2O4S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20-4-2;;;1-5(2,3)4/h11-12H,3-10,13-20H2,1-2H3;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of disodium;propyl octadec-9-enoate;sulfate?
disodium;propyl octadec-9-enoate;sulfate has a molecular weight of 466.59 g/mol, XLogP of -0.35, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;propyl octadec-9-enoate;sulfate is sourced from PubChem (CID 173063888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).