C16H20N2O12S2 — CID 11752318
1-[8-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-8-oxooctanoyl]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 11752318) has the molecular formula C16H20N2O12S2 and a molecular weight of 496.47 g/mol. Its IUPAC name is 1-[8-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-8-oxooctanoyl]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[8-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-8-oxooctanoyl]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 11752318 |
| Molecular Formula | C16H20N2O12S2 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 1-[8-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-8-oxooctanoyl]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | O=C(CCCCCCC(=O)N1C(=O)CC(S(=O)(=O)O)C1=O)N1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C16H20N2O12S2/c19-11(17-13(21)7-9(15(17)23)31(25,26)27)5-3-1-2-4-6-12(20)18-14(22)8-10(16(18)24)32(28,29)30/h9-10H,1-8H2,(H,25,26,27)(H,28,29,30) |
| InChIKey | AQRLBHCZCXPKRI-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 217.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|