C11H22N2O3 — CID 63696542
1-[2-(2,2-dimethoxyethylamino)propyl]pyrrolidin-2-one (PubChem CID 63696542) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[2-(2,2-dimethoxyethylamino)propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(2,2-dimethoxyethylamino)propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 63696542 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-[2-(2,2-dimethoxyethylamino)propyl]pyrrolidin-2-one |
| SMILES | COC(CNC(C)CN1CCCC1=O)OC |
| InChI | InChI=1S/C11H22N2O3/c1-9(12-7-11(15-2)16-3)8-13-6-4-5-10(13)14/h9,11-12H,4-8H2,1-3H3 |
| InChIKey | ASBKRPXRHHAWEM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|