C11H17N3OS — CID 62758526
1-[2-(1,3-thiazol-5-ylmethylamino)propyl]pyrrolidin-2-one (PubChem CID 62758526) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-[2-(1,3-thiazol-5-ylmethylamino)propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-(1,3-thiazol-5-ylmethylamino)propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 62758526 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-[2-(1,3-thiazol-5-ylmethylamino)propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NCc1cncs1 |
| InChI | InChI=1S/C11H17N3OS/c1-9(7-14-4-2-3-11(14)15)13-6-10-5-12-8-16-10/h5,8-9,13H,2-4,6-7H2,1H3 |
| InChIKey | RZVSHODISAEXTL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |