C13H21N3O — CID 66399198
1-[2-[(1-methylpyrrol-3-yl)methylamino]propyl]pyrrolidin-2-one (PubChem CID 66399198) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[2-[(1-methylpyrrol-3-yl)methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(1-methylpyrrol-3-yl)methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66399198 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[2-[(1-methylpyrrol-3-yl)methylamino]propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NCc1ccn(C)c1 |
| InChI | InChI=1S/C13H21N3O/c1-11(9-16-6-3-4-13(16)17)14-8-12-5-7-15(2)10-12/h5,7,10-11,14H,3-4,6,8-9H2,1-2H3 |
| InChIKey | SFWBDGCBDSGJCI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |