C17H25N3O — CID 62096164
1-[2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propyl]pyrrolidin-2-one (PubChem CID 62096164) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-[2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 62096164 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-[2-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NCc1ccc2c(c1)CCN2C |
| InChI | InChI=1S/C17H25N3O/c1-13(12-20-8-3-4-17(20)21)18-11-14-5-6-16-15(10-14)7-9-19(16)2/h5-6,10,13,18H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | AHFYCBUQPPZLCF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|