C8H14N2O3 — CID 43447638
1-(3-amino-2-hydroxypropyl)piperidine-2,6-dione (PubChem CID 43447638) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3-amino-2-hydroxypropyl)piperidine-2,6-dione.
| Compound Name | 1-(3-amino-2-hydroxypropyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 43447638 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(3-amino-2-hydroxypropyl)piperidine-2,6-dione |
| SMILES | NCC(O)CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C8H14N2O3/c9-4-6(11)5-10-7(12)2-1-3-8(10)13/h6,11H,1-5,9H2 |
| InChIKey | CRTDUTHOKPPVGZ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|