C8H12N2O4 — CID 106172345
3-(2,6-dioxopiperidin-1-yl)-2-hydroxypropanamide (PubChem CID 106172345) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-(2,6-dioxopiperidin-1-yl)-2-hydroxypropanamide.
| Compound Name | 3-(2,6-dioxopiperidin-1-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106172345 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-(2,6-dioxopiperidin-1-yl)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CN1C(=O)CCCC1=O |
| InChI | InChI=1S/C8H12N2O4/c9-8(14)5(11)4-10-6(12)2-1-3-7(10)13/h5,11H,1-4H2,(H2,9,14) |
| InChIKey | ZDDOTLJEFLPTJD-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|