C13H14FNO3 — CID 113463158
1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidine-2,6-dione (PubChem CID 113463158) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidine-2,6-dione.
| Compound Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 113463158 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CC(O)c1ccccc1F |
| InChI | InChI=1S/C13H14FNO3/c14-10-5-2-1-4-9(10)11(16)8-15-12(17)6-3-7-13(15)18/h1-2,4-5,11,16H,3,6-8H2 |
| InChIKey | QDRCNTLEUIWHDI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|