C19H27FN2O2 — CID 111496584
1-[[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-4-yl]methyl]piperidin-2-one (PubChem CID 111496584) has the molecular formula C19H27FN2O2 and a molecular weight of 334.43 g/mol. Its IUPAC name is 1-[[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-4-yl]methyl]piperidin-2-one.
| Compound Name | 1-[[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-4-yl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 111496584 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-[[1-[2-(2-fluorophenyl)-2-hydroxyethyl]piperidin-4-yl]methyl]piperidin-2-one |
| SMILES | O=C1CCCCN1CC1CCN(CC(O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN2O2/c20-17-6-2-1-5-16(17)18(23)14-21-11-8-15(9-12-21)13-22-10-4-3-7-19(22)24/h1-2,5-6,15,18,23H,3-4,7-14H2 |
| InChIKey | HLYACMMAUZFCID-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |