C14H18BrNO4 — CID 63628396
6-bromo-4-(2,2-diethoxyethyl)-1,4-benzoxazin-3-one (PubChem CID 63628396) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is 6-bromo-4-(2,2-diethoxyethyl)-1,4-benzoxazin-3-one.
| Compound Name | 6-bromo-4-(2,2-diethoxyethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 63628396 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 6-bromo-4-(2,2-diethoxyethyl)-1,4-benzoxazin-3-one |
| SMILES | CCOC(CN1C(=O)COc2ccc(Br)cc21)OCC |
| InChI | InChI=1S/C14H18BrNO4/c1-3-18-14(19-4-2)8-16-11-7-10(15)5-6-12(11)20-9-13(16)17/h5-7,14H,3-4,8-9H2,1-2H3 |
| InChIKey | HGSLMINIBRMDAG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|