C12H11BrN2O2 — CID 43153008
4-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)butanenitrile (PubChem CID 43153008) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 4-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)butanenitrile.
| Compound Name | 4-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)butanenitrile |
|---|---|
| PubChem CID | 43153008 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 4-(6-bromo-3-oxo-1,4-benzoxazin-4-yl)butanenitrile |
| SMILES | N#CCCCN1C(=O)COc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H11BrN2O2/c13-9-3-4-11-10(7-9)15(6-2-1-5-14)12(16)8-17-11/h3-4,7H,1-2,6,8H2 |
| InChIKey | KLSFKYAUGZBKCW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|