About 1-(4-iodobutyl)azepane-2,7-dione
1-(4-iodobutyl)azepane-2,7-dione (PubChem CID 139913177) has the molecular formula C10H16INO2
and a molecular weight of 309.15 g/mol. Its IUPAC name is 1-(4-iodobutyl)azepane-2,7-dione.
Molecular Properties
| Compound Name | 1-(4-iodobutyl)azepane-2,7-dione |
| PubChem CID | 139913177 |
| Molecular Formula | C10H16INO2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 1-(4-iodobutyl)azepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1CCCCI |
| InChI | InChI=1S/C10H16INO2/c11-7-3-4-8-12-9(13)5-1-2-6-10(12)14/h1-8H2 |
| InChIKey | JUNSJEACIHGTLI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-iodobutyl)azepane-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-iodobutyl)azepane-2,7-dione?
The IUPAC name of 1-(4-iodobutyl)azepane-2,7-dione (CID 139913177) is 1-(4-iodobutyl)azepane-2,7-dione.
What is the SMILES notation for 1-(4-iodobutyl)azepane-2,7-dione?
The canonical SMILES for 1-(4-iodobutyl)azepane-2,7-dione is O=C1CCCCC(=O)N1CCCCI.
What is the InChIKey of 1-(4-iodobutyl)azepane-2,7-dione?
The InChIKey is JUNSJEACIHGTLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16INO2/c11-7-3-4-8-12-9(13)5-1-2-6-10(12)14/h1-8H2.
What are the key properties of 1-(4-iodobutyl)azepane-2,7-dione?
1-(4-iodobutyl)azepane-2,7-dione has a molecular weight of 309.15 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-iodobutyl)azepane-2,7-dione is sourced from PubChem (CID 139913177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).