C14H20N2O — CID 61388037
1-[3-(methylamino)propyl]-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 61388037) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-[3-(methylamino)propyl]-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-[3-(methylamino)propyl]-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 61388037 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-[3-(methylamino)propyl]-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CNCCCN1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C14H20N2O/c1-15-10-5-11-16-13-8-3-2-6-12(13)7-4-9-14(16)17/h2-3,6,8,15H,4-5,7,9-11H2,1H3 |
| InChIKey | JFZPROHCBSLEPF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|