C10H13N3O — CID 24703377
2-(2,3-dihydroindol-1-yl)-N'-hydroxyethanimidamide (PubChem CID 24703377) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 24703377 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-N'-hydroxyethanimidamide |
| SMILES | N/C(CN1CCc2ccccc21)=N\O |
| InChI | InChI=1S/C10H13N3O/c11-10(12-14)7-13-6-5-8-3-1-2-4-9(8)13/h1-4,14H,5-7H2,(H2,11,12) |
| InChIKey | YIDJTXKMHKSHPU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|