C9H11N3O — CID 126972145
N'-hydroxy-2,3-dihydroindole-1-carboximidamide (PubChem CID 126972145) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is N'-hydroxy-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-hydroxy-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 126972145 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N'-hydroxy-2,3-dihydroindole-1-carboximidamide |
| SMILES | N/C(=N\O)N1CCc2ccccc21 |
| InChI | InChI=1S/C9H11N3O/c10-9(11-13)12-6-5-7-3-1-2-4-8(7)12/h1-4,13H,5-6H2,(H2,10,11) |
| InChIKey | JNBWKHQGJVLHBG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|