C22H21N5O — CID 123661378
N'-[N'-(4-phenoxyphenyl)carbamimidoyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 123661378) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N'-[N'-(4-phenoxyphenyl)carbamimidoyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-[N'-(4-phenoxyphenyl)carbamimidoyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 123661378 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N'-[N'-(4-phenoxyphenyl)carbamimidoyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | NC(=N/C(N)=N/c1ccc(Oc2ccccc2)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H21N5O/c23-21(26-22(24)27-15-14-16-6-4-5-9-20(16)27)25-17-10-12-19(13-11-17)28-18-7-2-1-3-8-18/h1-13H,14-15H2,(H4,23,24,25,26) |
| InChIKey | UPPPQCDSQWLHAX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|