C22H21N3O — CID 18709570
N'-[2-(4-methoxyphenyl)phenyl]-2,3-dihydroindole-1-carboximidamide (PubChem CID 18709570) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenyl)phenyl]-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-[2-(4-methoxyphenyl)phenyl]-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 18709570 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N'-[2-(4-methoxyphenyl)phenyl]-2,3-dihydroindole-1-carboximidamide |
| SMILES | COc1ccc(-c2ccccc2/N=C(\N)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-26-18-12-10-16(11-13-18)19-7-3-4-8-20(19)24-22(23)25-15-14-17-6-2-5-9-21(17)25/h2-13H,14-15H2,1H3,(H2,23,24) |
| InChIKey | SGWFPZWENVLYOD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|