C16H18ClN3 — CID 23503705
N'-(3-methylphenyl)-2,3-dihydroindole-1-carboximidamide;hydrochloride (PubChem CID 23503705) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is N'-(3-methylphenyl)-2,3-dihydroindole-1-carboximidamide;hydrochloride.
| Compound Name | N'-(3-methylphenyl)-2,3-dihydroindole-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 23503705 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N'-(3-methylphenyl)-2,3-dihydroindole-1-carboximidamide;hydrochloride |
| SMILES | Cc1cccc(/N=C(\N)N2CCc3ccccc32)c1.Cl |
| InChI | InChI=1S/C16H17N3.ClH/c1-12-5-4-7-14(11-12)18-16(17)19-10-9-13-6-2-3-8-15(13)19;/h2-8,11H,9-10H2,1H3,(H2,17,18);1H |
| InChIKey | MKEXTMISSGZHOY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|