C16H15F2N3 — CID 18709592
N'-(3,4-difluorophenyl)-3,4-dihydro-2H-quinoline-1-carboximidamide (PubChem CID 18709592) has the molecular formula C16H15F2N3 and a molecular weight of 287.31 g/mol. Its IUPAC name is N'-(3,4-difluorophenyl)-3,4-dihydro-2H-quinoline-1-carboximidamide.
| Compound Name | N'-(3,4-difluorophenyl)-3,4-dihydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 18709592 |
| Molecular Formula | C16H15F2N3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N'-(3,4-difluorophenyl)-3,4-dihydro-2H-quinoline-1-carboximidamide |
| SMILES | N/C(=N\c1ccc(F)c(F)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C16H15F2N3/c17-13-8-7-12(10-14(13)18)20-16(19)21-9-3-5-11-4-1-2-6-15(11)21/h1-2,4,6-8,10H,3,5,9H2,(H2,19,20) |
| InChIKey | BUBPUSNLYDAGEH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|