C14H15N5 — CID 17036150
N'-pyrimidin-2-yl-3,4-dihydro-2H-quinoline-1-carboximidamide (PubChem CID 17036150) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is N'-pyrimidin-2-yl-3,4-dihydro-2H-quinoline-1-carboximidamide.
| Compound Name | N'-pyrimidin-2-yl-3,4-dihydro-2H-quinoline-1-carboximidamide |
|---|---|
| PubChem CID | 17036150 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N'-pyrimidin-2-yl-3,4-dihydro-2H-quinoline-1-carboximidamide |
| SMILES | N/C(=N\c1ncccn1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C14H15N5/c15-13(18-14-16-8-4-9-17-14)19-10-3-6-11-5-1-2-7-12(11)19/h1-2,4-5,7-9H,3,6,10H2,(H2,15,16,17,18) |
| InChIKey | RRHLFJPGVCAHBC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|